For research use only. Not for therapeutic Use.
Di-sec-butyl Phthalate is a high-purity compound used in polymer chemistry and material science. This phthalate ester is essential for studying plasticization processes and improving the flexibility and durability of polymers. Its precise composition ensures reliable and reproducible results, making it indispensable for advanced material science applications and polymer research. Ideal for experimental setups, Di-sec-butyl Phthalate enhances research accuracy and efficiency.
CAS Number | 4489-61-6 |
Synonyms | 1,2-Benzenedicarboxylic Acid 1,2-Bis(1-methylpropyl) Ester; Phthalic Acid Di-sec-butyl Ester; |
Molecular Formula | C16H22O4 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | dibutan-2-yl benzene-1,2-dicarboxylate |
InChI | InChI=1S/C16H22O4/c1-5-11(3)19-15(17)13-9-7-8-10-14(13)16(18)20-12(4)6-2/h7-12H,5-6H2,1-4H3 |
InChIKey | HAPGVMADJBQOGC-UHFFFAOYSA-N |
SMILES | CCC(C)OC(=O)C1=CC=CC=C1C(=O)OC(C)CC |