For research use only. Not for therapeutic Use.
DiABZI STING agonist-1 Tautomerism (Cat.No:I019741) is diABZI STING Agonist-1 is a potent small-molecule stimulator of the STING (Stimulator of Interferon Genes) pathway, essential for innate immune response. Its tautomeric forms, interconverting between two isomers, play a crucial role in its pharmacological activity. By activating STING, diABZI STING Agonist-1 enhances the production of type I interferons and cytokines, showing promise in cancer immunotherapy and infectious disease treatments. Its ability to modulate immune response makes it a valuable tool for therapeutic development.
CAS Number | 2138498-18-5 |
Molecular Formula | C₄₂H₅₁N₁₃O₇ |
Purity | ≥95% |
Target | STING |
IUPAC Name | 1-[(E)-4-[5-carbamoyl-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-7-(3-morpholin-4-ylpropoxy)benzimidazol-1-yl]but-2-enyl]-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-7-methoxybenzimidazole-5-carboxamide |
InChI | InChI=1S/C42H51N13O7/c1-6-54-31(19-25(3)49-54)39(58)47-41-45-29-21-27(37(43)56)23-33(60-5)35(29)52(41)12-8-9-13-53-36-30(46-42(53)48-40(59)32-20-26(4)50-55(32)7-2)22-28(38(44)57)24-34(36)62-16-10-11-51-14-17-61-18-15-51/h8-9,19-24H,6-7,10-18H2,1-5H3,(H2,43,56)(H2,44,57)(H,45,47,58)(H,46,48,59)/b9-8+ |
InChIKey | JGLMVXWAHNTPRF-CMDGGOBGSA-N |
SMILES | CCN1C(=CC(=N1)C)C(=O)NC2=NC3=C(N2C/C=C/CN4C5=C(C=C(C=C5OCCCN6CCOCC6)C(=O)N)N=C4NC(=O)C7=CC(=NN7CC)C)C(=CC(=C3)C(=O)N)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |