For research use only. Not for therapeutic Use.
Diacetazotol inhibits dioxin-induced ethoxyresorufin-O-deethylase (EROD) activity with IC50 of 75±4 nM. Diacetazotol extracts from patent US20070032458, compound 3.
Diacetazotol has activity for inhibiting dioxin toxicity[1].
| Catalog Number | I013126 |
| CAS Number | 83-63-6 |
| Synonyms | N-acetyl-N-[2-methyl-4-[(2-methylphenyl)diazenyl]phenyl]acetamide |
| Molecular Formula | C18H19N3O2 |
| Purity | ≥95% |
| InChI | InChI=1S/C18H19N3O2/c1-12-7-5-6-8-17(12)20-19-16-9-10-18(13(2)11-16)21(14(3)22)15(4)23/h5-11H,1-4H3 |
| InChIKey | YIEDSISPYKQADU-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1N=NC2=CC(=C(C=C2)N(C(=O)C)C(=O)C)C |
| Reference | [1]. Pann Suh, et al. Compound having activity for inhibiting dioxin toxicity, pharmaceutical composition comprising the compound and method for treating disease resulting from dioxin toxicity using the compound .US 20070032458 A1. |
