For research use only. Not for therapeutic Use.
Diallyl N, N-diisopropyl phosphoramidite（Cat No.:M107637） is a chemical compound used primarily as an intermediate in organic synthesis, particularly in the preparation of modified oligonucleotides and other phosphorus-containing compounds. Its structure includes phosphorus bonded to nitrogen and isopropyl groups, with additional vinyl groups that facilitate further chemical reactions. This reagent is valuable in the field of molecular biology and genetic engineering, where it is utilized to synthesize DNA and RNA sequences with specific modifications, enhancing their stability and functionality for research or therapeutic purposes.
| Catalog Number | M107637 |
| CAS Number | 126429-21-8 |
| Molecular Formula | C12H24NO2P |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | N-bis(prop-2-enoxy)phosphanyl-N-propan-2-ylpropan-2-amine |
| InChI | InChI=1S/C12H24NO2P/c1-7-9-14-16(15-10-8-2)13(11(3)4)12(5)6/h7-8,11-12H,1-2,9-10H2,3-6H3 |
| InChIKey | QBLCHHSGJTUNSJ-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)P(OCC=C)OCC=C |
