For research use only. Not for therapeutic Use.
Diammonium dimolybdate (Cat.No:I026034) is an inorganic compound used in various industrial applications. It is commonly employed as a catalyst in chemical reactions and as a source of molybdenum in the production of catalysts, pigments, and fertilizers. Its unique properties make it valuable in diverse fields such as chemistry, metallurgy, and agriculture.
| Catalog Number | I026034 |
| CAS Number | 27546-07-2 |
| Synonyms | Diammonium dimolybdate |
| Molecular Formula | H8Mo2N2O7 |
| Purity | ≥95% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4℃ for short term (days to weeks) or -20℃ for long term (months to years). |
| IUPAC Name | azane;hydroxy-(hydroxy(dioxo)molybdenio)oxy-dioxomolybdenum |
| InChI | InChI=1S/2Mo.2H3N.2H2O.5O/h;;2*1H3;2*1H2;;;;;/q2*+1;;;;;;;;;/p-2 |
| InChIKey | XUFUCDNVOXXQQC-UHFFFAOYSA-L |
| SMILES | N.N.O[Mo](=O)(=O)O[Mo](=O)(=O)O |
