For research use only. Not for therapeutic Use.
Diamthazole hydrochloride(Cat No.:I041311)is a synthetic compound primarily investigated for its potential antifungal and antimicrobial properties. It functions by inhibiting key enzymes involved in the biosynthesis of essential cellular components in pathogens, disrupting their growth and replication. Diamthazole hydrochloride has shown promise in preclinical studies as an effective treatment for fungal infections, particularly in cases resistant to other antifungal agents. Its broad-spectrum activity also extends to certain bacterial pathogens. Ongoing research aims to further explore its pharmacological profile, optimizing its efficacy and safety for clinical use in treating infections caused by resistant microorganisms.
CAS Number | 17140-69-1 |
Synonyms | 6-[2-(diethylamino)ethoxy]-N,N-dimethyl-1,3-benzothiazol-2-amine;hydrochloride |
Molecular Formula | C15H24ClN3OS |
Purity | ≥95% |
IUPAC Name | 6-[2-(diethylamino)ethoxy]-N,N-dimethyl-1,3-benzothiazol-2-amine;hydrochloride |
InChI | InChI=1S/C15H23N3OS.ClH/c1-5-18(6-2)9-10-19-12-7-8-13-14(11-12)20-15(16-13)17(3)4;/h7-8,11H,5-6,9-10H2,1-4H3;1H |
InChIKey | LYMNPRAIEYTRSZ-UHFFFAOYSA-N |
SMILES | CCN(CC)CCOC1=CC2=C(C=C1)N=C(S2)N(C)C.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |