For research use only. Not for therapeutic Use.
Dibenzazepine-10,11-dione (Cat No.: R057588) also known as Dibenzazepinodione. It is an impurity of oxcarbazepine and is mainly used as an impurity reference substance.
| Catalog Number | R057588 |
| CAS Number | 19579-83-0 |
| Synonyms | 5H-Dibenz[b,f]azepine-10,11-dione; Dibenzazepinodione; |
| Molecular Formula | C14H9NO2 |
| Purity | ≥95% |
| Storage | Store at +4C |
| IUPAC Name | 11H-benzo[b][1]benzazepine-5,6-dione |
| InChI | InChI=1S/C14H9NO2/c16-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)14(13)17/h1-8,15H |
| InChIKey | JDPDFSIEJKKSEC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=O)C3=CC=CC=C3N2 |
