For research use only. Not for therapeutic Use.
Dibenzo[a,i]pyrene-d14(Cat No.:R057739) is a deuterated variant of Dibenzo[a,i]pyrene, featuring fourteen deuterium atoms that enhance its stability and make it suitable for precise analytical studies in environmental science and toxicology. This polycyclic aromatic hydrocarbon (PAH) is known for its potent carcinogenic properties, making it a significant concern in pollution and public health studies. The deuteration aids in the accurate detection and quantification of this compound in complex mixtures, such as soil and water samples, allowing for detailed assessments of its distribution, persistence, and biological impacts in environmental systems.
CAS Number | 158776-07-9 |
Synonyms | Benzo[rst]pentaphene-d14; Benzo[rst]pentacene-d14; 1,2:7,8-Dibenzpyrene-d14; 3,4:9,10-Dibenzopyrene-d14; Dibenzo[b,h]pyrene-d14; NSC 87521-d14; |
Molecular Formula | C24H14 |
Purity | ≥95% |
Storage | Store at +4C |
IUPAC Name | 3,4,5,6,8,10,11,13,15,16,17,18,21,22-tetradecadeuteriohexacyclo[10.10.2.02,7.09,23.014,19.020,24]tetracosa-1(23),2,4,6,8,10,12,14,16,18,20(24),21-dodecaene |
InChI | InChI=1S/C24H14/c1-3-7-19-15(5-1)13-17-9-10-18-14-16-6-2-4-8-20(16)22-12-11-21(19)23(17)24(18)22/h1-14H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D,13D,14D |
InChIKey | TUGYIJVAYAHHHM-WZAAGXFHSA-N |
SMILES | [2H]C1=C(C(=C2C3=C4C(=C(C2=C1[2H])[2H])C(=C(C5=C(C6=C(C(=C(C(=C6C(=C54)C(=C3[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H] |