For research use only. Not for therapeutic Use.
Dibenzo[b,d]thiophen-3-ylboronic acid(Cat No.:L006809). It features a dibenzo[b,d]thiophene backbone substituted with a boronic acid group at the 3-position. This compound is vital in organic synthesis and catalysis, acting as a key reagent in Suzuki-Miyaura cross-coupling reactions and other organic transformations. Its unique structure enables precise and selective chemical reactions, making it valuable in the synthesis of complex organic molecules, including pharmaceuticals, agrochemicals, and materials. Researchers use it as a versatile building block, contributing to advancements in drug discovery, materials science, and the development of specialized organic compounds.
CAS Number | 108847-24-1 |
Molecular Formula | C12H9BO2S |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | dibenzothiophen-3-ylboronic acid |
InChI | InChI=1S/C12H9BO2S/c14-13(15)8-5-6-10-9-3-1-2-4-11(9)16-12(10)7-8/h1-7,14-15H |
InChIKey | NHVNWPIMHDTDPP-UHFFFAOYSA-N |
SMILES | B(C1=CC2=C(C=C1)C3=CC=CC=C3S2)(O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |