For research use only. Not for therapeutic Use.
Dibenzo[b,e]thiepin-11(6H)-one (Cat No.:M049608) is a tricyclic compound with a unique sulfur-containing ring structure. It is of interest in the field of organic synthesis and medicinal chemistry due to its potential pharmacological activities. The thiepin core is related to tricyclic antidepressants, and derivatives of this compound have been studied for their potential as antidepressant and anxiolytic agents.
Catalog Number | M049608 |
CAS Number | 1531-77-7 |
Molecular Formula | C14H10OS |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | 6H-benzo[c][1]benzothiepin-11-one |
InChI | InChI=1S/C14H10OS/c15-14-11-6-2-1-5-10(11)9-16-13-8-4-3-7-12(13)14/h1-8H,9H2 |
InChIKey | JGJDEWXZEIHBNW-UHFFFAOYSA-N |
SMILES | C1C2=CC=CC=C2C(=O)C3=CC=CC=C3S1 |