For research use only. Not for therapeutic Use.
Dibenzo[b,g][1,5]naphthyridine-6,12(5H,11H)-dione(Cat No.:M083868) is a polycyclic organic compound that belongs to the naphthyridine group, known for its two fused benzene rings which add to its structural complexity and aromaticity. This compound contains two ketone groups (dione), which significantly impact its chemical reactivity and physical properties. It is primarily of interest in pharmaceutical and chemical research due to its potential in drug development, particularly for creating compounds with specific biological activities.
CAS Number | 17352-37-3 |
Molecular Formula | C16H10N2O2 |
Purity | ≥95% |
Storage | Store at -20C |
IUPAC Name | 5,11-dihydroquinolino[3,2-b]quinoline-6,12-dione |
InChI | InChI=1S/C16H10N2O2/c19-15-9-5-1-3-7-11(9)17-14-13(15)18-12-8-4-2-6-10(12)16(14)20/h1-8H,(H,17,19)(H,18,20) |
InChIKey | NUJGNDIAVBGFHG-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(=O)C3=C(N2)C(=O)C4=CC=CC=C4N3 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |