For research use only. Not for therapeutic Use.
Dibenzothiophene-5-oxide(Cat No.:M071724)is a sulfur-containing aromatic compound, notable for its unique structure featuring two benzene rings fused to a thiophene ring with an oxygen atom at the 5-position. This oxide modification imparts significant electronic properties, making it crucial in materials science, particularly in the development of organic semiconductors and photovoltaic materials. In environmental science, it is studied for its behavior in combustion processes and its role in sulfur oxide emissions. Additionally, its chemical properties are exploited in the synthesis of advanced pharmaceuticals and agrochemicals due to its potential as a versatile synthetic intermediate.
CAS Number | 1013-23-6 |
Molecular Formula | C12H8OS |
Purity | ≥95% |
IUPAC Name | dibenzothiophene 5-oxide |
InChI | InChI=1S/C12H8OS/c13-14-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-8H |
InChIKey | NGDPCAMPVQYGCW-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3S2=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |