For research use only. Not for therapeutic Use.
Dibenzoylmethane (DBM)(CAT: M070730) is an organic compound that belongs to the class of diketones. It is primarily known for its role as a UV-absorbing agent and is used in the cosmetic industry, particularly in sunscreens, where it helps to protect the skin from harmful ultraviolet radiation. DBM also has potential antioxidant and anticancer properties, making it of interest in biomedical research. Additionally, it is used as a chelating agent in coordination chemistry due to its ability to form complexes with metal ions. Its versatility and stability make Dibenzoylmethane valuable in both industrial and scientific applications.
| Catalog Number | M070730 |
| CAS Number | 120-46-7 |
| Molecular Formula | C15H12O2 |
| Purity | ≥95% |
| Target | Keap1-Nrf2 |
| Storage | -20°C |
| IUPAC Name | 1,3-diphenylpropane-1,3-dione |
| InChI | InChI=1S/C15H12O2/c16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13/h1-10H,11H2 |
| InChIKey | NZZIMKJIVMHWJC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CC(=O)C2=CC=CC=C2 |
