For research use only. Not for therapeutic Use.
Dibenzyl phthalate (Cat No.:R017636) is a chemical compound used as a plasticizer in various applications. It belongs to the class of phthalate esters and is utilized to increase the flexibility, durability, and workability of plastics and polymers. Dibenzyl phthalate is commonly used in the production of vinyl flooring, adhesives, and coatings. However, its use has raised concerns due to potential health and environmental risks associated with certain phthalates.
| Catalog Number | R017636 |
| CAS Number | 523-31-9 |
| Synonyms | 1,2-Benzenedicarboxylic Acid, 1,2-Bis(phenylmethyl) Ester?1,2-Benzenedicarboxylic Acid, Bis(phenylmethyl) Ester (9CI); Phthalic Acid, Dibenzyl Ester (6CI,7CI,8CI); Benzyl Phthalate; NSC 4057 |
| Molecular Formula | C22H18O4 |
| Purity | ≥95% |
| Storage | Room Temperature |
| IUPAC Name | dibenzyl benzene-1,2-dicarboxylate |
| InChI | InChI=1S/C22H18O4/c23-21(25-15-17-9-3-1-4-10-17)19-13-7-8-14-20(19)22(24)26-16-18-11-5-2-6-12-18/h1-14H,15-16H2 |
| InChIKey | UCVPKAZCQPRWAY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=CC=CC=C2C(=O)OCC3=CC=CC=C3 |
