For research use only. Not for therapeutic Use.
Dibromobimane（Cat No.:R020707）is a fluorescent dye commonly used in biochemistry and cell biology for detecting thiol groups in proteins, peptides, and other biological molecules. It reacts with thiol groups (–SH) to form a highly fluorescent adduct, making it a useful tool for studying oxidative stress and redox biology. Dibromobimane is often employed in assays to measure intracellular glutathione levels, protein thiol modifications, and other redox-related processes. Its ability to selectively label thiol groups makes it valuable in research related to cell signaling, drug development, and the study of reactive oxygen species (ROS).
| CAS Number | 68654-25-1 |
| Synonyms | 1,7-bis(bromomethyl)-2,6-dimethylpyrazolo[1,2-a]pyrazole-3,5-dione |
| Molecular Formula | C10H10Br2N2O2 |
| Purity | ≥95% |
| IUPAC Name | 1,7-bis(bromomethyl)-2,6-dimethylpyrazolo[1,2-a]pyrazole-3,5-dione |
| InChI | InChI=1S/C10H10Br2N2O2/c1-5-7(3-11)13-8(4-12)6(2)10(16)14(13)9(5)15/h3-4H2,1-2H3 |
| InChIKey | OSIYFMVMZXJKSP-UHFFFAOYSA-N |
| SMILES | CC1=C(N2C(=C(C(=O)N2C1=O)C)CBr)CBr |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
