For research use only. Not for therapeutic Use.
Dibromofluoromethane is a halomethane compound with the chemical formula CBr2F2. It is a colorless, nonflammable gas used primarily in fire suppression systems and as a refrigerant. Its effectiveness in extinguishing fires stems from its ability to inhibit the chemical reactions occurring in flames. Additionally, dibromofluoromethane is utilized in certain organic synthesis processes as a halogenating agent.
CAS Number | 1868-53-7 |
Synonyms | Fluorodibromomethane; |
Molecular Formula | CHBr2F |
Purity | ≥95% |
Storage | Desiccate at RT |
IUPAC Name | dibromo(fluoro)methane |
InChI | InChI=1S/CHBr2F/c2-1(3)4/h1H |
InChIKey | LTUTVFXOEGMHMP-UHFFFAOYSA-N |
SMILES | C(F)(Br)Br |