For research use only. Not for therapeutic Use.
Dibromoisocyanuric acid (Cat.No:M064426) is a chemical compound used as a disinfectant and sanitizer in water treatment processes and swimming pools. It releases bromine when dissolved in water, effectively killing bacteria and algae. Its efficacy and stability make it a valuable choice for water purification and sanitation applications.
CAS Number | 15114-43-9 |
Molecular Formula | C3HBr2N3O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1,3-dibromo-1,3,5-triazinane-2,4,6-trione |
InChI | InChI=1S/C3HBr2N3O3/c4-7-1(9)6-2(10)8(5)3(7)11/h(H,6,9,10) |
InChIKey | HHBCEKAWSILOOP-UHFFFAOYSA-N |
SMILES | C1(=O)NC(=O)N(C(=O)N1Br)Br |