For research use only. Not for therapeutic Use.
Dibuprol (Cat.No:I026055) is a chemical compound with potential pharmaceutical applications. It is known for its antihypertensive properties, making it useful in the treatment of high blood pressure. Dibuprol acts by relaxing and dilating blood vessels, thereby reducing blood pressure.
| Catalog Number | I026055 |
| CAS Number | 2216-77-5 |
| Synonyms | Dibuprol; NSC 71470; NSC-71470; NSC71470 |
| Molecular Formula | C11H24O3 |
| Purity | ≥95% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4℃ for short term (days to weeks) or -20℃ for long term (months to years). |
| IUPAC Name | 1,3-Dibutoxy-2-propanol |
| InChI | InChI=1S/C11H24O3/c1-3-5-7-13-9-11(12)10-14-8-6-4-2/h11-12H,3-10H2,1-2H3 |
| InChIKey | InChI=1S/C11H24O3/c1-3-5-7-13-9-11(12)10-14-8-6-4-2/h11-12H,3-10H2,1-2H3 |
| SMILES | OC(COCCCC)COCCCC |
