Home
>
Catalysts and Ligands>Nonchiral nitrogen ligands>
>
Dibutyl 2,2'-bipyridine-4,4'-dicarboxylate
For research use only. Not for therapeutic Use.
Dibutyl 2,2′-bipyridine-4,4′-dicarboxylate(Cat No.:L006753). It contains two bipyridine units, each with a butyl ester group attached at the 4-position. This compound is widely used in coordination chemistry and materials science. Its unique structure allows it to form coordination complexes with various metal ions, making it valuable in the design and synthesis of luminescent materials and catalysts. Researchers leverage its chemical properties to create functional materials, sensors, and organic light-emitting diodes (OLEDs), contributing to advancements in the fields of optics, electronics, and catalysis.
Catalog Number | L006753 |
CAS Number | 69641-93-6 |
Molecular Formula | C20H24N2O4 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | butyl 2-(4-butoxycarbonylpyridin-2-yl)pyridine-4-carboxylate |
InChI | InChI=1S/C20H24N2O4/c1-3-5-11-25-19(23)15-7-9-21-17(13-15)18-14-16(8-10-22-18)20(24)26-12-6-4-2/h7-10,13-14H,3-6,11-12H2,1-2H3 |
InChIKey | XJRBANJUKBOCLR-UHFFFAOYSA-N |
SMILES | CCCCOC(=O)C1=CC(=NC=C1)C2=NC=CC(=C2)C(=O)OCCCC |