For research use only. Not for therapeutic Use.
Dibutyl carbonate (Cat No.:R032376) is an organic compound used as a solvent, plasticizer, and intermediate in various industrial applications. It is a clear liquid with low volatility and good solvating properties, making it suitable for use in coatings, adhesives, and polymers. Dibutyl carbonate is also employed as a reaction medium for various chemical processes, including carbonylation reactions. Its relatively low toxicity and favorable environmental profile make it a preferred choice in applications where alternative solvents with higher volatility or toxicity might be unsuitable. Additionally, it serves as a building block in the synthesis of other compounds.
CAS Number | 542-52-9 |
Synonyms | NSC 8462; n-Butyl Carbonate; Carbonic acid, dibutyl ester; n-Butyl carbonate; Di-n-butyl carbonate |
Molecular Formula | C9H18O3 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | dibutyl carbonate |
InChI | InChI=1S/C9H18O3/c1-3-5-7-11-9(10)12-8-6-4-2/h3-8H2,1-2H3 |
InChIKey | QLVWOKQMDLQXNN-UHFFFAOYSA-N |
SMILES | CCCCOC(=O)OCCCC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |