For research use only. Not for therapeutic Use.
Dibutyl chlorinate (Cat No.:M121252) is an organic chemical compound that contains both chlorine and carbon atoms. It is used in various chemical reactions as a reagent to introduce chloroalkyl groups into molecules. Dibutyl chlorinate is commonly used in the synthesis of organic compounds, including pharmaceuticals, agrochemicals, and other specialty chemicals. It participates in reactions such as nucleophilic substitution and Friedel-Crafts reactions to modify and create new chemical structures.
| Catalog Number | M121252 |
| CAS Number | 1770-80-5 |
| Molecular Formula | C17H20Cl6O4 |
| Purity | ≥95% |
| Storage | 2-8°C |
| IUPAC Name | dibutyl 1,2,3,4,7,7-hexachlorobicyclo[2.2.1]hept-2-ene-5,6-dicarboxylate |
| InChI | InChI=1S/C17H20Cl6O4/c1-3-5-7-26-13(24)9-10(14(25)27-8-6-4-2)16(21)12(19)11(18)15(9,20)17(16,22)23/h9-10H,3-8H2,1-2H3 |
| InChIKey | UJAHPBDUQZFDLA-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)C1C(C2(C(=C(C1(C2(Cl)Cl)Cl)Cl)Cl)Cl)C(=O)OCCCC |
