For research use only. Not for therapeutic Use.
Dibutyl phthalate (DBP) is an organic compound used primarily as a plasticizer, imparting flexibility and durability to plastics, especially in polyvinyl chloride (PVC) applications. It appears as a colorless, oily liquid and is also found in adhesives, inks, and coatings. Concerns about DBP’s potential health effects, including endocrine disruption, have led to increased research and regulatory scrutiny. Studies focus on its environmental impact, toxicology, and the development of safer alternatives in industrial applications.
| Catalog Number | R049180 |
| CAS Number | 84-74-2 |
| Synonyms | 1,2-Benzenedicarboxylic Acid 1,2-Dibutyl Ester; Phthalic Acid Dibutyl Ester; Bis-n-butyl Phthalate; Butyl Phthalate; DBP; Di(n-butyl) 1,2-Benzenedicarboxylate; Di-n-butyl Phthalate; Dibutyl o-Phthalate; Elaol; Ergoplast Genoplast B; Hatco DBP; |
| Molecular Formula | C16H22O4 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | dibutyl benzene-1,2-dicarboxylate |
| InChI | InChI=1S/C16H22O4/c1-3-5-11-19-15(17)13-9-7-8-10-14(13)16(18)20-12-6-4-2/h7-10H,3-6,11-12H2,1-2H3 |
| InChIKey | DOIRQSBPFJWKBE-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC |
