For research use only. Not for therapeutic Use.
Dibutylcyanamide（Cat No.:L007046）, is a chemical compound featuring two butyl groups (C4H9) attached to a cyanamide group (NCNH2). It is a clear liquid and is used primarily as a reagent in organic synthesis. Dibutylcyanamide is employed in various reactions, including condensation and addition reactions, making it valuable in the preparation of complex organic molecules. Its unique structure allows it to participate in diverse transformations, contributing to the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals. Dibutylcyanamide’s versatility in organic reactions makes it significant in the field of organic chemistry, enabling the creation of a wide range of functionalized compounds.
| Catalog Number | L007046 |
| CAS Number | 2050-54-6 |
| Molecular Formula | C9H18N2 |
| Purity | ≥95% |
| Storage | Room Temperature |
| IUPAC Name | dibutylcyanamide |
| InChI | InChI=1S/C9H18N2/c1-3-5-7-11(9-10)8-6-4-2/h3-8H2,1-2H3 |
| InChIKey | SOGFATPCYLMCMQ-UHFFFAOYSA-N |
| SMILES | CCCCN(CCCC)C#N |
