For research use only. Not for therapeutic Use.
Dichloroacetate (Cat No.:M065544) is a chemical compound with the formula CHCl2COOH. It is a synthetic organic compound that has been studied for its potential therapeutic applications, particularly in cancer treatment and metabolic disorders. Dichloroacetate inhibits an enzyme involved in cellular energy metabolism, leading to a shift towards aerobic metabolism and apoptosis in certain cancer cells. It has also been investigated for its potential to treat metabolic diseases like congenital lactic acidosis.
| Catalog Number | M065544 |
| CAS Number | 13425-80-4 |
| Synonyms | ACETICACID,DICHLORO-,ION(1-) |
| Molecular Formula | C2HCl2O2- |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2,2-dichloroacetate |
| InChI | InChI=1S/C2H2Cl2O2/c3-1(4)2(5)6/h1H,(H,5,6)/p-1 |
| InChIKey | JXTHNDFMNIQAHM-UHFFFAOYSA-M |
| SMILES | C(C(=O)[O-])(Cl)Cl |
