For research use only. Not for therapeutic Use.
Dichloroacetic Acid is a high-purity compound used in biochemical research and medical studies. This halogenated acetic acid derivative is essential for investigating metabolic pathways, mitochondrial function, and as a potential therapeutic agent for certain metabolic disorders and cancers. Its precise composition ensures reliable and reproducible results, making it indispensable for advanced biochemical and pharmaceutical research. Ideal for experimental setups, Dichloroacetic Acid enhances research accuracy and efficacy in various scientific investigations.
CAS Number | 79-43-6 |
Synonyms | 2,2-Dichloroacetic Acid; DCA; DCA (acid); DCAA; DKhUK; Dichlorethanoic Acid; Dichloroacetic Acid; Dichloroethanoic Acid; NSC 2654; |
Molecular Formula | C2H2Cl2O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2,2-dichloroacetic acid |
InChI | InChI=1S/C2H2Cl2O2/c3-1(4)2(5)6/h1H,(H,5,6) |
InChIKey | JXTHNDFMNIQAHM-UHFFFAOYSA-N |
SMILES | C(C(=O)O)(Cl)Cl |