Home
>
Catalysts and Ligands>Transition metal> Dichloro[bis(diphenylphosphinophenyl)ether]palladium(II)
For research use only. Not for therapeutic Use.
Dichloro[bis(diphenylphosphinophenyl)ether]palladium(II) is a coordination compound featuring palladium(II) as the central metal atom, coordinated with two diphenylphosphinophenyl ether ligands and two chloride ions. Its chemical formula can be represented as PdCl₂(C₁₄H₁₁P)₂. This compound is significant in catalysis, particularly in cross-coupling reactions such as Suzuki and Heck reactions, due to the electron-rich nature of the diphenylphosphine ligands. Its unique structure enhances the stability and reactivity of palladium, making it a valuable catalyst in organic synthesis.
Catalog Number | L023002 |
CAS Number | 205319-06-8 |
Molecular Formula | C36H28Cl2OP2Pd |
Purity | ≥95% |
IUPAC Name | dichloropalladium;[2-(2-diphenylphosphanylphenoxy)phenyl]-diphenylphosphane |
InChI | InChI=1S/C36H28OP2.2ClH.Pd/c1-5-17-29(18-6-1)38(30-19-7-2-8-20-30)35-27-15-13-25-33(35)37-34-26-14-16-28-36(34)39(31-21-9-3-10-22-31)32-23-11-4-12-24-32;;;/h1-28H;2*1H;/q;;;+2/p-2 |
InChIKey | VYOUBMJFTDMKRR-UHFFFAOYSA-L |
SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3OC4=CC=CC=C4P(C5=CC=CC=C5)C6=CC=CC=C6.Cl[Pd]Cl |