For research use only. Not for therapeutic Use.
Dichloroglyoxime（Cat No.:M006985）is a high-purity organic compound widely used in chemical and pharmaceutical research. This molecule features two chlorine atoms attached to a glyoxime core, making it a valuable intermediate in the synthesis of coordination compounds and chelating agents. Its unique structure allows for selective reactivity, particularly in the formation of metal complexes, which are crucial in catalysis and material science. Dichloroglyoxime is essential for precise synthetic applications, contributing to advancements in coordination chemistry, catalysis, and the development of novel materials and therapeutic agents.
| Catalog Number | M006985 |
| CAS Number | 2038-44-0 |
| Synonyms | Oxalohydroximoyl chloride;1,2-Dichloroglyoxime;dco;Dichloroglyoxime;dihydroxyethanediimidoyl dichloride;dihydroxy-ethanediimidoyl dichlorid;Ethanediimidoyl dichloride,dihydroxy-;1,2-Dichloroethane-1,2-dione dioxime |
| Molecular Formula | C2H2Cl2N2O2 |
| Purity | ≥95% |
| IUPAC Name | (1Z,2Z)-N,N'-dihydroxyethanediimidoyl dichloride |
| InChI | InChI=1S/C2H2Cl2N2O2/c3-1(5-7)2(4)6-8/h7-8H/b5-1-,6-2- |
| InChIKey | KTQVJAPIQPIIPF-IOBHVTPZSA-N |
| SMILES | C(=NO)(C(=NO)Cl)Cl |
