For research use only. Not for therapeutic Use.
Dichlorophen(Cat No.:I005711)is an antiparasitic and antifungal agent used primarily in veterinary medicine to treat tapeworms and fungal infections in animals. It works by disrupting the energy metabolism of parasites and fungi, leading to cellular dysfunction and death. Often combined with other anthelmintics, dichlorophen is effective against various intestinal parasites, particularly tapeworms in dogs and cats. Additionally, it has applications in controlling fungal growth in environments prone to mold. Its efficacy and broad-spectrum action make dichlorophen a valuable compound in parasite and fungal control for pet health and sanitation.
Catalog Number | I005711 |
CAS Number | 97-23-4 |
Molecular Formula | C13H10Cl2O2 |
Purity | ≥95% |
Target | Parasite |
Solubility | 10 mM in DMSO |
Storage | Store at -20℃ |
IUPAC Name | 4-chloro-2-[(5-chloro-2-hydroxyphenyl)methyl]phenol |
InChI | InChI=1S/C13H10Cl2O2/c14-10-1-3-12(16)8(6-10)5-9-7-11(15)2-4-13(9)17/h1-4,6-7,16-17H,5H2 |
InChIKey | MDNWOSOZYLHTCG-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1Cl)CC2=C(C=CC(=C2)Cl)O)O |
Reference | /Dichlorophen./ Veterinary Substances Database (VSDB). University of Hertfordshire, 2016. Web.</span></p> |