For research use only. Not for therapeutic Use.
Dicyclohexyl Phthalate (Cat.No:R039569) is a chemical compound used as a plasticizer in various industries, particularly in the production of flexible plastics. It imparts flexibility and durability to polymers. Additionally, it finds applications in adhesives, coatings, and other industrial processes, enhancing the properties of finished products.
| Catalog Number | R039569 |
| CAS Number | 84-61-7 |
| Synonyms | 1,2-Benzenedicarboxylic Acid 1,2-Dicyclohexyl Ester; Phthalic Acid Dicyclohexyl Ester; DCHP; Edenol DCHP; Ergoplast FDC; HF 191; Howflex CP; KP 201; Morflex 150; NSC 6101; Unimoll 66; Uniplex 250; DCHP |
| Molecular Formula | C20H26O4 |
| Purity | ≥95% |
| Storage | Store at +4C |
| IUPAC Name | dicyclohexyl benzene-1,2-dicarboxylate |
| InChI | InChI=1S/C20H26O4/c21-19(23-15-9-3-1-4-10-15)17-13-7-8-14-18(17)20(22)24-16-11-5-2-6-12-16/h7-8,13-16H,1-6,9-12H2 |
| InChIKey | VOWAEIGWURALJQ-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)OC(=O)C2=CC=CC=C2C(=O)OC3CCCCC3 |
