For research use only. Not for therapeutic Use.
Dicyclohexylamine 2-cyanoacrylate(Cat No.:M027052) is a chemical compound formed by the reaction of dicyclohexylamine with 2-cyanoacrylic acid. This results in a cyanoacrylate ester, which is a class of fast-acting adhesives known for their strong bonding capabilities. Dicyclohexylamine 2-cyanoacrylate, in particular, offers unique properties due to the bulky dicyclohexylamine group, potentially providing enhanced thermal stability and reduced brittleness compared to traditional cyanoacrylates. This makes it suitable for specialized adhesive applications where enhanced performance under varying environmental conditions is required, such as in industrial or automotive settings.
CAS Number | 263703-32-8 |
Molecular Formula | C16H26N2O2 |
Purity | ≥95% |
IUPAC Name | 2-cyanoprop-2-enoic acid;N-cyclohexylcyclohexanamine |
InChI | InChI=1S/C12H23N.C4H3NO2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3(2-5)4(6)7/h11-13H,1-10H2;1H2,(H,6,7) |
InChIKey | KBUNPAIJSVOOSU-UHFFFAOYSA-N |
SMILES | C=C(C#N)C(=O)O.C1CCC(CC1)NC2CCCCC2 |