Home
>
Bioactive Chemicals>Amino acids> Dicyclohexylamine (2S,3R)-2-((tert-butoxycarbonyl)amino)-3-hydroxybutanoate
For research use only. Not for therapeutic Use.
Dicyclohexylamine (2S,3R)-2-((tert-butoxycarbonyl)amino)-3-hydroxybutanoate(Cat No.:L025625)is a chiral intermediate used in the synthesis of complex organic molecules, particularly in the pharmaceutical industry. This compound features a (2S,3R)-configured butanoate backbone with a tert-butoxycarbonyl (Boc) protected amino group and a hydroxyl group, making it ideal for peptide synthesis and other stereoselective applications. The dicyclohexylamine component enhances solubility and stability. It plays a crucial role in the development of enantiomerically pure drugs, serving as a key building block in medicinal chemistry and drug discovery efforts.
Catalog Number | L025625 |
CAS Number | 13564-70-0 |
Molecular Formula | C21H40N2O5 |
Purity | ≥95% |
IUPAC Name | N-cyclohexylcyclohexanamine;(2S,3R)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
InChI | InChI=1S/C12H23N.C9H17NO5/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-5(11)6(7(12)13)10-8(14)15-9(2,3)4/h11-13H,1-10H2;5-6,11H,1-4H3,(H,10,14)(H,12,13)/t;5-,6+/m.1/s1 |
InChIKey | BBZZIJOSFVOUGF-BCBTXJGPSA-N |
SMILES | CC(C(C(=O)O)NC(=O)OC(C)(C)C)O.C1CCC(CC1)NC2CCCCC2 |