For research use only. Not for therapeutic Use.
Dicyclohexylamine(CAT: R028660) is an organic compound known for its applications in various industries. It is a secondary amine consisting of two cyclohexyl groups attached to a central amine functional group. Dicyclohexylamine is widely used as a chemical intermediate in the synthesis of pharmaceuticals, agrochemicals, rubber additives, and corrosion inhibitors. Its unique chemical properties make it valuable in the formation of complex organic molecules, especially in the production of drugs and chemicals.
| Catalog Number | R028660 |
| CAS Number | 101-83-7 |
| Synonyms | Aminodicyclohexane; Bis(cyclohexyl)amine; D-CHA-T; Dodecahydrodiphenylamine; N,N-Dicyclohexylamine; N-Cyclohexylcyclohexanamine; NSC 3399 |
| Molecular Formula | C12H23N |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | N-cyclohexylcyclohexanamine |
| InChI | InChI=1S/C12H23N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h11-13H,1-10H2 |
| InChIKey | XBPCUCUWBYBCDP-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC2CCCCC2 |
