For research use only. Not for therapeutic Use.
Dicyclohexylborane（Cat No.:M049680）, is an organoboron compound characterized by two cyclohexyl groups attached to a boron atom. This chemical appears as a colorless to pale yellow liquid. It is primarily used in organic synthesis, particularly in hydroboration reactions, where it adds across carbon-carbon double bonds to form organoboranes. These intermediates are useful for further chemical transformations, such as oxidation or Suzuki coupling reactions, making dicyclohexylborane a valuable tool in the synthesis of complex organic molecules. Its use extends to pharmaceutical research and development for constructing key molecular frameworks.
| Catalog Number | M049680 |
| CAS Number | 1568-65-6 |
| Synonyms | Dicyclohexylborane |
| Molecular Formula | C12H22B |
| Purity | ≥95% |
| Storage | -20°C |
| InChI | InChI=1S/C12H22B/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h11-12H,1-10H2 |
| InChIKey | LUHUASWMJCSDTG-UHFFFAOYSA-N |
| SMILES | [B](C1CCCCC1)C2CCCCC2 |
