For research use only. Not for therapeutic Use.
Dicyclopentadiene dioxide (Cat.No:R070454) is a chemical compound derived from dicyclopentadiene (DCPD), a hydrocarbon. It is used in the production of epoxy resins, which find applications in coatings, adhesives, and composites. This compound’s unique structure lends durability and chemical resistance to various materials in industries like automotive and aerospace.
| Catalog Number | R070454 |
| CAS Number | 81-21-0 |
| Molecular Formula | C10H12O2 |
| Purity | ≥95% |
| Storage | RT |
| InChI | InChI=1S/C10H12O2/c1-4-3-2-6-10(11-6)7(3)5(1)9-8(4)12-9/h3-10H,1-2H2 |
| InChIKey | BQQUFAMSJAKLNB-UHFFFAOYSA-N |
| SMILES | C1C2C3CC4C(C3C1C5C2O5)O4 |
