For research use only. Not for therapeutic Use.
Dicyclopropylamine hydrochloride（Cat No.:L039547）is a cycloalkylamine compound used in pharmaceutical and chemical research. It features two cyclopropyl groups attached to an amine, with the hydrochloride salt enhancing its stability and solubility. This compound is valuable as a building block in the synthesis of bioactive molecules, including potential drug candidates and agrochemicals. Its unique structure provides reactivity that is useful for creating complex chemical entities. Dicyclopropylamine hydrochloride is essential for researchers focused on innovative synthetic methodologies, drug discovery, and the development of advanced chemical products.
| Catalog Number | L039547 |
| CAS Number | 246257-69-2 |
| Molecular Formula | C6H12ClN |
| Purity | ≥95% |
| IUPAC Name | N-cyclopropylcyclopropanamine;hydrochloride |
| InChI | InChI=1S/C6H11N.ClH/c1-2-5(1)7-6-3-4-6;/h5-7H,1-4H2;1H |
| InChIKey | FUIHNRAZVMHKIS-UHFFFAOYSA-N |
| SMILES | C1CC1NC2CC2.Cl |
