For research use only. Not for therapeutic Use.
Dideoxyadenosine(CAT: R047152) is a modified nucleoside derivative. Its mode of action involves serving as a chain-terminating nucleotide analog during DNA synthesis, specifically acting as a substrate for DNA polymerase. Pharmacologically, dideoxyadenosine lacks a 3′ hydroxyl group necessary for further nucleotide addition, thus halting DNA synthesis. It has been used in DNA sequencing techniques, particularly the Sanger sequencing method, allowing for the determination of DNA sequences. Its applications extend to genetic research, diagnostics, and molecular biology, providing a crucial tool for deciphering the genetic code and understanding the sequence of nucleotides in DNA strands.
| Catalog Number | R047152 |
| CAS Number | 4097-22-7 |
| Synonyms | 2’,3’-Dideoxyadenosine; NSC 98700; USP Didanosine Related Compound B; |
| Molecular Formula | C10H13N5O2 |
| Purity | ≥95% |
| Storage | Room temperature |
| IUPAC Name | [(2S,5R)-5-(6-aminopurin-9-yl)oxolan-2-yl]methanol |
| InChI | InChI=1S/C10H13N5O2/c11-9-8-10(13-4-12-9)15(5-14-8)7-2-1-6(3-16)17-7/h4-7,16H,1-3H2,(H2,11,12,13)/t6-,7+/m0/s1 |
| InChIKey | WVXRAFOPTSTNLL-NKWVEPMBSA-N |
| SMILES | C1CC(OC1CO)N2C=NC3=C2N=CN=C3N |
