For research use only. Not for therapeutic Use.
Didesmethyl Cariprazine(CAT: I017501) is an active metabolite of cariprazine, a dopamine D3/D2 receptor partial agonist with preferential binding to D3 receptors. It plays a significant role in the pharmacological profile of cariprazine, contributing to its long-lasting therapeutic effects. This compound is particularly valuable in neuroscience research, supporting studies on schizophrenia, bipolar disorder, and major depressive disorder. Didesmethyl Cariprazine is essential for understanding the metabolism, pharmacodynamics, and receptor interactions of cariprazine, aiding the development of novel treatments targeting dopaminergic pathways in neuropsychiatric disorders.
CAS Number | 839712-25-3 |
Molecular Formula | C₁₉H₂₈Cl₂N₄O |
Purity | ≥95% |
Target | Neuronal Signaling |
IUPAC Name | [4-[2-[4-(2,3-dichlorophenyl)piperazin-1-yl]ethyl]cyclohexyl]urea |
InChI | InChI=1S/C19H28Cl2N4O/c20-16-2-1-3-17(18(16)21)25-12-10-24(11-13-25)9-8-14-4-6-15(7-5-14)23-19(22)26/h1-3,14-15H,4-13H2,(H3,22,23,26) |
InChIKey | UMTWXZNVNBBFLC-UHFFFAOYSA-N |
SMILES | C1CC(CCC1CCN2CCN(CC2)C3=C(C(=CC=C3)Cl)Cl)NC(=O)N |