For research use only. Not for therapeutic Use.
Didrovaltrate (Cat No.:M078651) is a compound derived from Valeriana officinalis, commonly known as valerian. Valerian is a plant used for its potential sedative and anxiolytic effects. Didrovaltrate is believed to contribute to these effects, although its precise mechanisms of action are not fully understood. Valerian preparations, which may contain didrovaltrate, have been used traditionally to alleviate anxiety and improve sleep quality.
| Catalog Number | M078651 |
| CAS Number | 18296-45-2 |
| Molecular Formula | C22H32O8 |
| Purity | ≥95% |
| Target | Disease Research Fields |
| Storage | -20°C |
| IUPAC Name | [(1S,4aS,6S,7R,7aS)-6-acetyloxy-1-(3-methylbutanoyloxy)spiro[4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-7,2/'-oxirane]-4-yl]methyl 3-methylbutanoate |
| InChI | InChI=1S/C22H32O8/c1-12(2)6-18(24)26-9-15-10-27-21(30-19(25)7-13(3)4)20-16(15)8-17(29-14(5)23)22(20)11-28-22/h10,12-13,16-17,20-21H,6-9,11H2,1-5H3/t16-,17+,20-,21+,22-/m1/s1 |
| InChIKey | PHHROXLDZHUIGO-PNBTUHDLSA-N |
| SMILES | CC(C)CC(=O)OCC1=COC(C2C1CC(C23CO3)OC(=O)C)OC(=O)CC(C)C |
