For research use only. Not for therapeutic Use.
Diethanolamine-d8(Cat No.:R041928) is a deuterated form of diethanolamine, an organic compound used primarily as a surfactant and emulsifier in various industrial applications. Its deuterium labeling allows for precise analysis and identification in nuclear magnetic resonance (NMR) spectroscopy studies, aiding in the characterization of complex mixtures and reaction mechanisms. Diethanolamine-d8 finds use in research and quality control processes within the chemical industry.
CAS Number | 103691-51-6 |
Synonyms | 2,2’-iminobis-Ethan-1,1,2,2-d4-ol; |
Molecular Formula | C4H3D8NO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1,1,2,2-tetradeuterio-2-[(1,1,2,2-tetradeuterio-2-hydroxyethyl)amino]ethanol |
InChI | InChI=1S/C4H11NO2/c6-3-1-5-2-4-7/h5-7H,1-4H2/i1D2,2D2,3D2,4D2 |
InChIKey | ZBCBWPMODOFKDW-SVYQBANQSA-N |
SMILES | [2H]C([2H])(C([2H])([2H])O)NC([2H])([2H])C([2H])([2H])O |