For research use only. Not for therapeutic Use.
Diethoxyacetonitrile (Cat No.:R028285) is an organic compound that contains both ethoxy (C2H5O) and cyano (CN) functional groups. It is used in various chemical reactions as a building block in organic synthesis. Diethoxyacetonitrile can participate in reactions such as nucleophilic substitution and condensation reactions to form new chemical compounds. It serves as a versatile intermediate in the production of pharmaceuticals, agrochemicals, and other specialty chemicals. Its unique combination of functional groups makes it valuable in diverse transformations, contributing to the creation of complex molecules and the advancement of organic chemistry research.
CAS Number | 6136-93-2 |
Synonyms | Cyano-formaldehyde Diethyl Acetal; 2,2-Diethoxy-acetonitrile; Diethoxy-acetonitrile |
Molecular Formula | C6H11NO2 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 2,2-diethoxyacetonitrile |
InChI | InChI=1S/C6H11NO2/c1-3-8-6(5-7)9-4-2/h6H,3-4H2,1-2H3 |
InChIKey | UDELMRIGXNCYLU-UHFFFAOYSA-N |
SMILES | CCOC(C#N)OCC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |