For research use only. Not for therapeutic Use.
Diethyl 1H-pyrazole-3,5-dicarboxylate(CAT: L047307) is an organic compound derived from pyrazole, featuring two ester groups (-COOEt) attached at the 3 and 5 positions of the pyrazole ring. The ester groups make this compound useful in synthetic chemistry, especially in the preparation of more complex heterocyclic molecules. The pyrazole ring itself is a five-membered heterocycle containing two nitrogen atoms, offering unique electronic properties and potential biological activity. Diethyl 1H-pyrazole-3,5-dicarboxylate is commonly used as a building block in pharmaceuticals, agrochemicals, and materials science, where its dual ester functionality allows for further modification and chemical transformations in various synthetic pathways.
CAS Number | 37687-24-4 |
Molecular Formula | C9H12N2O4 |
Purity | ≥95% |
IUPAC Name | diethyl 1H-pyrazole-3,5-dicarboxylate |
InChI | InChI=1S/C9H12N2O4/c1-3-14-8(12)6-5-7(11-10-6)9(13)15-4-2/h5H,3-4H2,1-2H3,(H,10,11) |
InChIKey | MBWXLICVQZUJOW-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |