For research use only. Not for therapeutic Use.
Diethyl 2-(2-nitrobenzyl)malonate(Cat No.:L019804)is a specialized organic compound characterized by a malonate ester structure linked to a 2-nitrobenzyl group. This configuration makes it an essential intermediate in the synthesis of pharmaceuticals, particularly those involving complex ring systems or requiring specific functional groups for biological activity. The nitro group enhances the molecule’s reactivity, facilitating key transformations such as reduction and nucleophilic substitution. The diethyl ester groups improve solubility and allow for easy deprotonation, making it a versatile building block in organic synthesis, especially in constructing molecules with anti-inflammatory and analgesic properties.
Catalog Number | L019804 |
CAS Number | 59803-35-9 |
Molecular Formula | C14H17NO6 |
Purity | ≥95% |
IUPAC Name | diethyl 2-[(2-nitrophenyl)methyl]propanedioate |
InChI | InChI=1S/C14H17NO6/c1-3-20-13(16)11(14(17)21-4-2)9-10-7-5-6-8-12(10)15(18)19/h5-8,11H,3-4,9H2,1-2H3 |
InChIKey | XKWHIUXRQYXRSG-UHFFFAOYSA-N |
SMILES | CCOC(=O)C(CC1=CC=CC=C1[N+](=O)[O-])C(=O)OCC |