For research use only. Not for therapeutic Use.
Diethyl 2,6-pyridinedicarboxylate(Cat No.:M087211)is a pyridine derivative where the nitrogen-containing ring is substituted with two ester groups at the 2 and 6 positions. This compound serves as a versatile intermediate in organic synthesis, particularly in the construction of complex molecules for pharmaceuticals and agrochemicals. The ester groups enhance its solubility and reactivity, facilitating esterification and other derivative-forming reactions. Its pyridine core is crucial for forming coordination compounds with metals, making it valuable in the development of catalysts and metal-organic frameworks. Diethyl 2,6-pyridinedicarboxylate is essential for advancing chemical research and material science applications.
CAS Number | 15658-60-3 |
Molecular Formula | C11H13NO4 |
Purity | ≥95% |
Storage | Store at -20C |
IUPAC Name | diethyl pyridine-2,6-dicarboxylate |
InChI | InChI=1S/C11H13NO4/c1-3-15-10(13)8-6-5-7-9(12-8)11(14)16-4-2/h5-7H,3-4H2,1-2H3 |
InChIKey | KTOBUCHVPBPHMK-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=NC(=CC=C1)C(=O)OCC |