For research use only. Not for therapeutic Use.
Diethyl pyridine-3,4-dicarboxylate(CAT: M120972) is a high-purity compound widely used in pharmaceutical, chemical, and material science research. Featuring a pyridine ring substituted with two ester groups at the 3- and 4-positions, this compound is a versatile intermediate for synthesizing bioactive molecules, including pharmaceuticals and agrochemicals. Its ester functionalities facilitate various chemical transformations such as hydrolysis, amidation, and transesterification, making it suitable for developing complex organic compounds. With reliable reactivity and consistent quality, Diethyl pyridine-3,4-dicarboxylate supports innovative research in medicinal chemistry and advanced organic synthesis.
CAS Number | 1678-52-0 |
Molecular Formula | C11H13NO4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | diethyl pyridine-3,4-dicarboxylate |
InChI | InChI=1S/C11H13NO4/c1-3-15-10(13)8-5-6-12-7-9(8)11(14)16-4-2/h5-7H,3-4H2,1-2H3 |
InChIKey | SIOSRDUNOOIMCE-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=C(C=NC=C1)C(=O)OCC |