For research use only. Not for therapeutic Use.
Diethyl 3-aminopentanedioate hydrochloride (Cat.No:L003721) is a crucial chemical compound utilized in pharmaceutical research. Its structure, featuring an aminopentanedioate group, imparts unique reactivity and properties. This compound serves as a valuable intermediate in the synthesis of specialized materials and pharmaceuticals. Its versatile nature makes it a crucial component in the development of diverse products across industries, highlighting its importance in the field of chemical synthesis and medicinal chemistry.
CAS Number | 60793-95-5 |
Molecular Formula | C9H18ClNO4 |
Purity | ≥95% |
IUPAC Name | diethyl 3-aminopentanedioate;hydrochloride |
InChI | InChI=1S/C9H17NO4.ClH/c1-3-13-8(11)5-7(10)6-9(12)14-4-2;/h7H,3-6,10H2,1-2H3;1H |
InChIKey | XCTVAGMMVHLHQU-UHFFFAOYSA-N |
SMILES | CCOC(=O)CC(CC(=O)OCC)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |