For research use only. Not for therapeutic Use.
Diethyl 3-oxocyclopentane-1,1-dicarboxylate (Cat No.:L020115 ) is an ester compound characterized by a cyclopentane ring with a ketone functional group at the 3-position and two carboxylate groups at the 1-position. This structure makes it a versatile intermediate in organic synthesis, particularly useful for constructing complex molecules. The diethyl ester moiety enhances solubility and reactivity, allowing for various chemical transformations. Its unique functional groups can be exploited in the synthesis of pharmaceuticals and agrochemicals, as well as in other applications in chemical research.
CAS Number | 180573-13-1 |
Molecular Formula | C11H16O5 |
Purity | ≥95% |
IUPAC Name | diethyl 3-oxocyclopentane-1,1-dicarboxylate |
InChI | InChI=1S/C11H16O5/c1-3-15-9(13)11(10(14)16-4-2)6-5-8(12)7-11/h3-7H2,1-2H3 |
InChIKey | XBSAEVIOKMQREK-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1(CCC(=O)C1)C(=O)OCC |