For research use only. Not for therapeutic Use.
Diethyl 3,5-dimethoxybenzylphosphonate is an organophosphorus compound used in organic synthesis and pharmaceutical research. Featuring a phosphonate group attached to a dimethoxy-substituted benzyl ring, it serves as a versatile intermediate for the synthesis of complex molecules, including bioactive compounds. This compound is particularly useful in the Horner-Wadsworth-Emmons reaction for the preparation of alkenes and other derivatives. Its role in medicinal chemistry supports the development of therapeutic agents and specialized materials, contributing to advancements in drug discovery and material science.
CAS Number | 108957-75-1 |
Synonyms | P-[(3,5-Dimethoxyphenyl)methyl]phosphonic Acid Diethyl Ester |
Molecular Formula | C13H21O5P |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-(diethoxyphosphorylmethyl)-3,5-dimethoxybenzene |
InChI | InChI=1S/C13H21O5P/c1-5-17-19(14,18-6-2)10-11-7-12(15-3)9-13(8-11)16-4/h7-9H,5-6,10H2,1-4H3 |
InChIKey | VYWCMXXBAOVBSJ-UHFFFAOYSA-N |
SMILES | CCOP(=O)(CC1=CC(=CC(=C1)OC)OC)OCC |