For research use only. Not for therapeutic Use.
Diethyl 5-aminoisophthalate hydrochloride（Cat No.:L046740）is a chemical compound. It consists of a phthalate core substituted with an amino group at the 5-position and two ethyl ester groups. This structure provides key functionalities for various synthetic applications, particularly in the creation of dyes, pigments, and pharmaceutical intermediates. The hydrochloride salt form enhances its solubility and stability, making it more manageable in aqueous reactions. This compound is especially useful in producing polymeric materials and fine chemicals where specific structural attributes are crucial for performance and efficacy.
| CAS Number | 42122-73-6 |
| Molecular Formula | C12H16ClNO4 |
| Purity | ≥95% |
| IUPAC Name | diethyl 5-aminobenzene-1,3-dicarboxylate;hydrochloride |
| InChI | InChI=1S/C12H15NO4.ClH/c1-3-16-11(14)8-5-9(7-10(13)6-8)12(15)17-4-2;/h5-7H,3-4,13H2,1-2H3;1H |
| InChIKey | KROZITDVWZMYOC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=CC(=C1)N)C(=O)OCC.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
