For research use only. Not for therapeutic Use.
Diethyl Azelate(Cat No.:L007045), is an organic compound derived from azelaic acid, a naturally occurring dicarboxylic acid. This ester consists of two ethyl groups attached to the azelaic acid backbone. Diethyl azelate is primarily used as a plasticizer in polymer production, enhancing flexibility and durability in various materials, including plastics, resins, and coatings. It also finds applications in the formulation of perfumes and fragrances due to its pleasant odor. Additionally, it serves as a chemical intermediate in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals, contributing to its significance in diverse industrial processes.
CAS Number | 624-17-9 |
Molecular Formula | C13H24O4 |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | diethyl nonanedioate |
InChI | InChI=1S/C13H24O4/c1-3-16-12(14)10-8-6-5-7-9-11-13(15)17-4-2/h3-11H2,1-2H3 |
InChIKey | CQMYCPZZIPXILQ-UHFFFAOYSA-N |
SMILES | CCOC(=O)CCCCCCCC(=O)OCC |