For research use only. Not for therapeutic Use.
Diethyl benzhydrylphosphonate (Cat.No:L004036) is a vital compound in organic synthesis. Its distinctive structure, featuring a benzhydrylphosphonate group, imparts unique reactivity and properties. This compound serves as a valuable reagent in the preparation of specialized organic molecules with various applications in pharmaceutical and chemical research.
CAS Number | 27329-60-8 |
Molecular Formula | C17H21O3P |
Purity | ≥95% |
IUPAC Name | [diethoxyphosphoryl(phenyl)methyl]benzene |
InChI | InChI=1S/C17H21O3P/c1-3-19-21(18,20-4-2)17(15-11-7-5-8-12-15)16-13-9-6-10-14-16/h5-14,17H,3-4H2,1-2H3 |
InChIKey | SVSCLSTYANOQQX-UHFFFAOYSA-N |
SMILES | CCOP(=O)(C(C1=CC=CC=C1)C2=CC=CC=C2)OCC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |